CAS 1206969-46-1 is the registry number for 3-((Pyridin-2-yl)methylamino)-[1,2,4]triazolo[4,3-a]pyridine-6-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
3-(pyridin-2-ylmethylamino)-[1,2,4]triazolo[4,3-a]pyridine-6-carboxylic acid (CAS 1206969-46-1) is a chemical compound with the molecular formula C13H11N5O2 and a molecular weight of 269.26 g/mol. IUPAC name: 3-(pyridin-2-ylmethylamino)-[1,2,4]triazolo[4,3-a]pyridine-6-carboxylic acid. InChIKey: GXXGUJJWPOYMQY-UHFFFAOYSA-N.
| Molecular formula | C13H11N5O2 |
|---|---|
| Molecular weight | 269.26 g/mol |
| IUPAC name | 3-(pyridin-2-ylmethylamino)-[1,2,4]triazolo[4,3-a]pyridine-6-carboxylic acid |
| InChIKey | GXXGUJJWPOYMQY-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)CNC2=NN=C3N2C=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)