CAS 901563-18-6 is the registry number for N-(5H-2,3,5-triazolyl)(5-methyl-3-phenylisoxazol-4-yl)formamide. Offered by: Biosynth. Available pack sizes: 5000mg.
5-methyl-3-phenyl-N-(1H-1,2,4-triazol-5-yl)-1,2-oxazole-4-carboxamide (CAS 901563-18-6) is a chemical compound with the molecular formula C13H11N5O2 and a molecular weight of 269.26 g/mol. IUPAC name: 5-methyl-3-phenyl-N-(1H-1,2,4-triazol-5-yl)-1,2-oxazole-4-carboxamide. InChIKey: ZETYGGNYGZGYKH-UHFFFAOYSA-N.
| Molecular formula | C13H11N5O2 |
|---|---|
| Molecular weight | 269.26 g/mol |
| IUPAC name | 5-methyl-3-phenyl-N-(1H-1,2,4-triazol-5-yl)-1,2-oxazole-4-carboxamide |
| InChIKey | ZETYGGNYGZGYKH-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C2=CC=CC=C2)C(=O)NC3=NC=NN3 |
Computed by PubChem (NCBI)