Products 112404-28-1
CAS 112404-28-1 is the registry number for 2-(2-(4-Methoxyphenyl)-2-oxoethyl)-5,5-dimethylcyclohexane-1,3-dione. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-[2-(4-methoxyphenyl)-2-oxoethyl]-5,5-dimethylcyclohexane-1,3-dione (CAS 112404-28-1) is a chemical compound with the molecular formula C17H20O4 and a molecular weight of 288.34 g/mol. IUPAC name: 2-[2-(4-methoxyphenyl)-2-oxoethyl]-5,5-dimethylcyclohexane-1,3-dione. InChIKey: ZNYKWRZMVVDEPQ-UHFFFAOYSA-N.
| Molecular formula | C17H20O4 |
|---|---|
| Molecular weight | 288.34 g/mol |
| IUPAC name | 2-[2-(4-methoxyphenyl)-2-oxoethyl]-5,5-dimethylcyclohexane-1,3-dione |
| InChIKey | ZNYKWRZMVVDEPQ-UHFFFAOYSA-N |
| SMILES | CC1(CC(=O)C(C(=O)C1)CC(=O)C2=CC=C(C=C2)OC)C |
Computed by PubChem (NCBI)