Products 112404-64-5
CAS 112404-64-5 is the registry number for 2-(benzyloxy)-3-isopropylbenzoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-phenylmethoxy-3-propan-2-ylbenzoic acid (CAS 112404-64-5) is a chemical compound with the molecular formula C17H18O3 and a molecular weight of 270.32 g/mol. IUPAC name: 2-phenylmethoxy-3-propan-2-ylbenzoic acid. InChIKey: XZQBEQYIMULXDM-UHFFFAOYSA-N.
| Molecular formula | C17H18O3 |
|---|---|
| Molecular weight | 270.32 g/mol |
| IUPAC name | 2-phenylmethoxy-3-propan-2-ylbenzoic acid |
| InChIKey | XZQBEQYIMULXDM-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C(=CC=C1)C(=O)O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)
Synonyms:
2-(benzyloxy)-3-isopropylbenzoic acid