CAS 112421-36-0 is the registry number for 4-Fluoro-etomidate. Offered by: TRC. Available pack sizes: 50mg.
Ethyl 3-[(1R)-1-(4-fluorophenyl)ethyl]imidazole-4-carboxylate (CAS 112421-36-0) is a chemical compound with the molecular formula C14H15FN2O2 and a molecular weight of 262.28 g/mol. IUPAC name: ethyl 3-[(1R)-1-(4-fluorophenyl)ethyl]imidazole-4-carboxylate. InChIKey: PTPSMJOSZBOCNF-SNVBAGLBSA-N.
| Molecular formula | C14H15FN2O2 |
|---|---|
| Molecular weight | 262.28 g/mol |
| IUPAC name | ethyl 3-[(1R)-1-(4-fluorophenyl)ethyl]imidazole-4-carboxylate |
| InChIKey | PTPSMJOSZBOCNF-SNVBAGLBSA-N |
| SMILES | CCOC(=O)C1=CN=CN1[C@H](C)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)