CAS 58038-66-7 appears in our catalog under these names: Ethyl 8–fluoro–1,3,4,5–tetrahydro–2H–pyrido–(4,3–b)indole–2–carboxylate, ethyl 8-fluoro-1,3,4,5-tetrahydro-2H-pyrido [4,3-b]indole-2-carboxylate, ≥97%, ≥97%. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g, 1mg, 5mg.
Ethyl 8-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carboxylate (CAS 58038-66-7) is a chemical compound with the molecular formula C14H15FN2O2 and a molecular weight of 262.28 g/mol. IUPAC name: ethyl 8-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carboxylate. InChIKey: OYAGMJMNTRNOCC-UHFFFAOYSA-N.
| Molecular formula | C14H15FN2O2 |
|---|---|
| Molecular weight | 262.28 g/mol |
| IUPAC name | ethyl 8-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carboxylate |
| InChIKey | OYAGMJMNTRNOCC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)N1CCC2=C(C1)C3=C(N2)C=CC(=C3)F |
Computed by PubChem (NCBI)