CAS 477710-46-6 is the registry number for Ethyl 1-(4-fluorophenyl)-3,5-dimethyl-1h-pyrazole-4-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Ethyl 1-(4-fluorophenyl)-3,5-dimethylpyrazole-4-carboxylate (CAS 477710-46-6) is a chemical compound with the molecular formula C14H15FN2O2 and a molecular weight of 262.28 g/mol. IUPAC name: ethyl 1-(4-fluorophenyl)-3,5-dimethylpyrazole-4-carboxylate. InChIKey: KRXPEHMOMPCHLF-UHFFFAOYSA-N.
| Molecular formula | C14H15FN2O2 |
|---|---|
| Molecular weight | 262.28 g/mol |
| IUPAC name | ethyl 1-(4-fluorophenyl)-3,5-dimethylpyrazole-4-carboxylate |
| InChIKey | KRXPEHMOMPCHLF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N(N=C1C)C2=CC=C(C=C2)F)C |
Computed by PubChem (NCBI)