CAS 954582-72-0 is the registry number for 2-(2-Amino-4-fluorophenyl)-octahydro-1H-isoindole-1,3-dione, 95%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
2-(2-amino-4-fluorophenyl)-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione (CAS 954582-72-0) is a chemical compound with the molecular formula C14H15FN2O2 and a molecular weight of 262.28 g/mol. IUPAC name: 2-(2-amino-4-fluorophenyl)-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione. InChIKey: QGNWTCQLEPCORK-UHFFFAOYSA-N.
| Molecular formula | C14H15FN2O2 |
|---|---|
| Molecular weight | 262.28 g/mol |
| IUPAC name | 2-(2-amino-4-fluorophenyl)-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
| InChIKey | QGNWTCQLEPCORK-UHFFFAOYSA-N |
| SMILES | C1CCC2C(C1)C(=O)N(C2=O)C3=C(C=C(C=C3)F)N |
Computed by PubChem (NCBI)