CAS 346441-17-6 appears in our catalog under these names: Ethyl 1-(3-fluorophenyl)-3,5-dimethyl-1h-pyrazole-4-carboxylate, 95%, Ethyl 1-(3-fluorophenyl)-3,5-dimethyl-1H-pyrazole-4-carboxylate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
Ethyl 1-(3-fluorophenyl)-3,5-dimethylpyrazole-4-carboxylate (CAS 346441-17-6) is a chemical compound with the molecular formula C14H15FN2O2 and a molecular weight of 262.28 g/mol. IUPAC name: ethyl 1-(3-fluorophenyl)-3,5-dimethylpyrazole-4-carboxylate. InChIKey: AHIZNCGDVCLPKS-UHFFFAOYSA-N.
| Molecular formula | C14H15FN2O2 |
|---|---|
| Molecular weight | 262.28 g/mol |
| IUPAC name | ethyl 1-(3-fluorophenyl)-3,5-dimethylpyrazole-4-carboxylate |
| InChIKey | AHIZNCGDVCLPKS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N(N=C1C)C2=CC(=CC=C2)F)C |
Computed by PubChem (NCBI)