CAS 112525-75-4 appears in our catalog under these names: (3-Methyl-4-(2,2,2-trifluoroethoxy)pyridin-2-yl)methyl acetate, 97%, Esomeprazole Impurity 18, Lansoprazole Impurity 7, Lansoprazole Impurity 39, (3-Methyl-4-(2,2,2-trifluoroethoxy)pyridin-2-yl)methyl Acetate, >95% (HPLC). Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1g, 500mg.
[3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl acetate (CAS 112525-75-4) is a chemical compound with the molecular formula C11H12F3NO3 and a molecular weight of 263.21 g/mol. IUPAC name: [3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl acetate. InChIKey: RVSNFCKBKKCQKC-UHFFFAOYSA-N.
| Molecular formula | C11H12F3NO3 |
|---|---|
| Molecular weight | 263.21 g/mol |
| IUPAC name | [3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl acetate |
| InChIKey | RVSNFCKBKKCQKC-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CN=C1COC(=O)C)OCC(F)(F)F |
Computed by PubChem (NCBI)