CAS 1126636-58-5 is the registry number for Ethyl 5-(3,5-difluorophenyl)isoxazole-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 5-(3,5-difluorophenyl)-1,2-oxazole-3-carboxylate (CAS 1126636-58-5) is a chemical compound with the molecular formula C12H9F2NO3 and a molecular weight of 253.20 g/mol. IUPAC name: ethyl 5-(3,5-difluorophenyl)-1,2-oxazole-3-carboxylate. InChIKey: GXKKERWVTYGSMW-UHFFFAOYSA-N.
| Molecular formula | C12H9F2NO3 |
|---|---|
| Molecular weight | 253.20 g/mol |
| IUPAC name | ethyl 5-(3,5-difluorophenyl)-1,2-oxazole-3-carboxylate |
| InChIKey | GXKKERWVTYGSMW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NOC(=C1)C2=CC(=CC(=C2)F)F |
Computed by PubChem (NCBI)