CAS 2095409-33-7 is the registry number for Ethyl 5-(2,4-difluorophenyl)oxazole-2-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 250mg, 1g.
Ethyl 5-(2,4-difluorophenyl)-1,3-oxazole-2-carboxylate (CAS 2095409-33-7) is a chemical compound with the molecular formula C12H9F2NO3 and a molecular weight of 253.20 g/mol. IUPAC name: ethyl 5-(2,4-difluorophenyl)-1,3-oxazole-2-carboxylate. InChIKey: FSPIBEUUSBVAPU-UHFFFAOYSA-N.
| Molecular formula | C12H9F2NO3 |
|---|---|
| Molecular weight | 253.20 g/mol |
| IUPAC name | ethyl 5-(2,4-difluorophenyl)-1,3-oxazole-2-carboxylate |
| InChIKey | FSPIBEUUSBVAPU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC=C(O1)C2=C(C=C(C=C2)F)F |
Computed by PubChem (NCBI)