CAS 951127-28-9 is the registry number for 6-(2,5-Difluorophenyl)-3,4-dihydro-3-methylene-5-nitro-2H-pyran. Offered by: TRC. Available pack sizes: 100mg.
6-(2,5-difluorophenyl)-3-methylidene-5-nitro-4H-pyran (CAS 951127-28-9) is a chemical compound with the molecular formula C12H9F2NO3 and a molecular weight of 253.20 g/mol. IUPAC name: 6-(2,5-difluorophenyl)-3-methylidene-5-nitro-4H-pyran. InChIKey: URWPQRNKFDALOW-UHFFFAOYSA-N.
| Molecular formula | C12H9F2NO3 |
|---|---|
| Molecular weight | 253.20 g/mol |
| IUPAC name | 6-(2,5-difluorophenyl)-3-methylidene-5-nitro-4H-pyran |
| InChIKey | URWPQRNKFDALOW-UHFFFAOYSA-N |
| SMILES | C=C1CC(=C(OC1)C2=C(C=CC(=C2)F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)