CAS 334971-36-7 is the registry number for Methyl 3-(2,6-difluorophenyl)-5-methylisoxazole-4-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 3-(2,6-difluorophenyl)-5-methyl-1,2-oxazole-4-carboxylate (CAS 334971-36-7) is a chemical compound with the molecular formula C12H9F2NO3 and a molecular weight of 253.20 g/mol. IUPAC name: methyl 3-(2,6-difluorophenyl)-5-methyl-1,2-oxazole-4-carboxylate. InChIKey: GDXXZGNNVCLIBP-UHFFFAOYSA-N.
| Molecular formula | C12H9F2NO3 |
|---|---|
| Molecular weight | 253.20 g/mol |
| IUPAC name | methyl 3-(2,6-difluorophenyl)-5-methyl-1,2-oxazole-4-carboxylate |
| InChIKey | GDXXZGNNVCLIBP-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C2=C(C=CC=C2F)F)C(=O)OC |
Computed by PubChem (NCBI)