CAS 923825-01-8 is the registry number for 3-(5-(2,4-Difluorophenyl)-1,3-oxazol-2-yl)propanoic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
3-[5-(2,4-difluorophenyl)-1,3-oxazol-2-yl]propanoic acid (CAS 923825-01-8) is a chemical compound with the molecular formula C12H9F2NO3 and a molecular weight of 253.20 g/mol. IUPAC name: 3-[5-(2,4-difluorophenyl)-1,3-oxazol-2-yl]propanoic acid. InChIKey: UXHQUUDVIZGIEK-UHFFFAOYSA-N.
| Molecular formula | C12H9F2NO3 |
|---|---|
| Molecular weight | 253.20 g/mol |
| IUPAC name | 3-[5-(2,4-difluorophenyl)-1,3-oxazol-2-yl]propanoic acid |
| InChIKey | UXHQUUDVIZGIEK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)C2=CN=C(O2)CCC(=O)O |
Computed by PubChem (NCBI)