Products 1127217-94-0

CAS 1127217-94-0 is the registry number for 5-(4-Chlorophenyl)-4-methyl-1,3-thiazole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 500mg, 1g, 2,5g, 5g, 10g.

Structural formula: {0} (CAS {1})

5-(4-chlorophenyl)-4-methyl-1,3-thiazole (CAS 1127217-94-0) is a chemical compound with the molecular formula C10H8ClNS and a molecular weight of 209.70 g/mol. IUPAC name: 5-(4-chlorophenyl)-4-methyl-1,3-thiazole. InChIKey: JSBABHOWFPBFNE-UHFFFAOYSA-N.

Identity
Molecular formulaC10H8ClNS
Molecular weight209.70 g/mol
IUPAC name5-(4-chlorophenyl)-4-methyl-1,3-thiazole
InChIKeyJSBABHOWFPBFNE-UHFFFAOYSA-N
SMILESCC1=C(SC=N1)C2=CC=C(C=C2)Cl

Computed by PubChem (NCBI)