CAS 1344352-94-8 is the registry number for 4-Benzyl-2-chlorothiazole, 95%. Offered by: AmBeed. Available pack sizes: 1g.
4-benzyl-2-chloro-1,3-thiazole (CAS 1344352-94-8) is a chemical compound with the molecular formula C10H8ClNS and a molecular weight of 209.70 g/mol. IUPAC name: 4-benzyl-2-chloro-1,3-thiazole. InChIKey: RBQKNRCVVQUQEQ-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNS |
|---|---|
| Molecular weight | 209.70 g/mol |
| IUPAC name | 4-benzyl-2-chloro-1,3-thiazole |
| InChIKey | RBQKNRCVVQUQEQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=CSC(=N2)Cl |
Computed by PubChem (NCBI)