CAS 83936-07-6 is the registry number for 4-Chloro-3-(methylsulfanyl)quinoline, 95%. Offered by: AmBeed. Available pack sizes: 1g.
4-chloro-3-methylsulfanylquinoline (CAS 83936-07-6) is a chemical compound with the molecular formula C10H8ClNS and a molecular weight of 209.70 g/mol. IUPAC name: 4-chloro-3-methylsulfanylquinoline. InChIKey: UNHNWVZKRDIFAP-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNS |
|---|---|
| Molecular weight | 209.70 g/mol |
| IUPAC name | 4-chloro-3-methylsulfanylquinoline |
| InChIKey | UNHNWVZKRDIFAP-UHFFFAOYSA-N |
| SMILES | CSC1=C(C2=CC=CC=C2N=C1)Cl |
Computed by PubChem (NCBI)