Products 1127218-05-6
CAS 1127218-05-6 is the registry number for 2-(3-Methoxyphenyl)-4,5-dimethylthiazole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 250mg, 500mg, 1g, 2,5g, 5g, 10g.
2-(3-methoxyphenyl)-4,5-dimethyl-1,3-thiazole (CAS 1127218-05-6) is a chemical compound with the molecular formula C12H13NOS and a molecular weight of 219.30 g/mol. IUPAC name: 2-(3-methoxyphenyl)-4,5-dimethyl-1,3-thiazole. InChIKey: CFSVCQKITJQOPJ-UHFFFAOYSA-N.
| Molecular formula | C12H13NOS |
|---|---|
| Molecular weight | 219.30 g/mol |
| IUPAC name | 2-(3-methoxyphenyl)-4,5-dimethyl-1,3-thiazole |
| InChIKey | CFSVCQKITJQOPJ-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)C2=CC(=CC=C2)OC)C |
Computed by PubChem (NCBI)