CAS 68837-61-6 appears in our catalog under these names: S,S-Diphenylsulfilimine monohydrate, 95%, S,S–Diphenylsulfilimine Monohydrate, S,S-Diphenylsulfilimine Monohydrate, >98.0%(HPLC)(T), S,S-diphenylsulfiliminemonohydrate, 98%. Offered by: Combi-blocks, GLPBio, TCI, Fluorochem. Available pack sizes: 1g, 5g, 200mg.
Imino(diphenyl)-lambda4-sulfane;hydrate (CAS 68837-61-6) is a chemical compound with the molecular formula C12H13NOS and a molecular weight of 219.30 g/mol. IUPAC name: imino(diphenyl)-lambda4-sulfane;hydrate. InChIKey: YLGYIQQZVOCMDO-UHFFFAOYSA-N.
| Molecular formula | C12H13NOS |
|---|---|
| Molecular weight | 219.30 g/mol |
| IUPAC name | imino(diphenyl)-lambda4-sulfane;hydrate |
| InChIKey | YLGYIQQZVOCMDO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=N)C2=CC=CC=C2.O |
Computed by PubChem (NCBI)