CAS 82955-19-9 is the registry number for 2-(2-Thienylmethylene)-3-quinuclidinone, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
(2E)-2-(thiophen-2-ylmethylidene)-1-azabicyclo[2.2.2]octan-3-one (CAS 82955-19-9) is a chemical compound with the molecular formula C12H13NOS and a molecular weight of 219.30 g/mol. IUPAC name: (2E)-2-(thiophen-2-ylmethylidene)-1-azabicyclo[2.2.2]octan-3-one. InChIKey: NZBSBCCCGCUASD-DHZHZOJOSA-N.
| Molecular formula | C12H13NOS |
|---|---|
| Molecular weight | 219.30 g/mol |
| IUPAC name | (2E)-2-(thiophen-2-ylmethylidene)-1-azabicyclo[2.2.2]octan-3-one |
| InChIKey | NZBSBCCCGCUASD-DHZHZOJOSA-N |
| SMILES | C1CN\2CCC1C(=O)/C2=C\C3=CC=CS3 |
Computed by PubChem (NCBI)