CAS 1221792-37-5 appears in our catalog under these names: 3,4-Dihydro-1h-spiro[naphthalene-2,2'-[1,3]thiazolidine]-4'-one, 95%, 3,4–Dihydro–1H–spiro(naphthalene–2,2'–(1,3)thiazolidine)–4'–one. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 5g, 500mg.
Spiro[1,3-thiazolidine-2,3'-2,4-dihydro-1H-naphthalene]-4-one (CAS 1221792-37-5) is a chemical compound with the molecular formula C12H13NOS and a molecular weight of 219.30 g/mol. IUPAC name: spiro[1,3-thiazolidine-2,3'-2,4-dihydro-1H-naphthalene]-4-one. InChIKey: OMHBHFDVHZBHJP-UHFFFAOYSA-N.
| Molecular formula | C12H13NOS |
|---|---|
| Molecular weight | 219.30 g/mol |
| IUPAC name | spiro[1,3-thiazolidine-2,3'-2,4-dihydro-1H-naphthalene]-4-one |
| InChIKey | OMHBHFDVHZBHJP-UHFFFAOYSA-N |
| SMILES | C1CC2(CC3=CC=CC=C31)NC(=O)CS2 |
Computed by PubChem (NCBI)