CAS 680214-97-5 is the registry number for 4-tert-Butylbenzoyl isothiocyanate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 5g, 250mg.
4-tert-butylbenzoyl isothiocyanate (CAS 680214-97-5) is a chemical compound with the molecular formula C12H13NOS and a molecular weight of 219.30 g/mol. IUPAC name: 4-tert-butylbenzoyl isothiocyanate. InChIKey: ISBLKWMZWUQAJN-UHFFFAOYSA-N.
| Molecular formula | C12H13NOS |
|---|---|
| Molecular weight | 219.30 g/mol |
| IUPAC name | 4-tert-butylbenzoyl isothiocyanate |
| InChIKey | ISBLKWMZWUQAJN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C(=O)N=C=S |
Computed by PubChem (NCBI)