Products 680214-97-5

CAS 680214-97-5 is the registry number for 4-tert-Butylbenzoyl isothiocyanate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 5g, 250mg.

Structural formula: {0} (CAS {1})

4-tert-butylbenzoyl isothiocyanate (CAS 680214-97-5) is a chemical compound with the molecular formula C12H13NOS and a molecular weight of 219.30 g/mol. IUPAC name: 4-tert-butylbenzoyl isothiocyanate. InChIKey: ISBLKWMZWUQAJN-UHFFFAOYSA-N.

Identity
Molecular formulaC12H13NOS
Molecular weight219.30 g/mol
IUPAC name4-tert-butylbenzoyl isothiocyanate
InChIKeyISBLKWMZWUQAJN-UHFFFAOYSA-N
SMILESCC(C)(C)C1=CC=C(C=C1)C(=O)N=C=S

Computed by PubChem (NCBI)