CAS 112806-56-1 is the registry number for 5,6-Dimethoxy-2-tosylisoindoline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5,6-dimethoxy-2-(4-methylphenyl)sulfonyl-1,3-dihydroisoindole (CAS 112806-56-1) is a chemical compound with the molecular formula C17H19NO4S and a molecular weight of 333.4 g/mol. IUPAC name: 5,6-dimethoxy-2-(4-methylphenyl)sulfonyl-1,3-dihydroisoindole. InChIKey: UVUCECCYCVBLQO-UHFFFAOYSA-N.
| Molecular formula | C17H19NO4S |
|---|---|
| Molecular weight | 333.4 g/mol |
| IUPAC name | 5,6-dimethoxy-2-(4-methylphenyl)sulfonyl-1,3-dihydroisoindole |
| InChIKey | UVUCECCYCVBLQO-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2CC3=CC(=C(C=C3C2)OC)OC |
Computed by PubChem (NCBI)