Products 112881-59-1
CAS 112881-59-1 is the registry number for Ethyl 5-amino-1-(4-methoxyphenyl)-1H-1,2,3-triazole-4-carboxylate. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
Ethyl 5-amino-1-(4-methoxyphenyl)triazole-4-carboxylate (CAS 112881-59-1) is a chemical compound with the molecular formula C12H14N4O3 and a molecular weight of 262.26 g/mol. IUPAC name: ethyl 5-amino-1-(4-methoxyphenyl)triazole-4-carboxylate. InChIKey: LXMWOFUMIWOJQP-UHFFFAOYSA-N.
| Molecular formula | C12H14N4O3 |
|---|---|
| Molecular weight | 262.26 g/mol |
| IUPAC name | ethyl 5-amino-1-(4-methoxyphenyl)triazole-4-carboxylate |
| InChIKey | LXMWOFUMIWOJQP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N(N=N1)C2=CC=C(C=C2)OC)N |
Computed by PubChem (NCBI)