CAS 112898-00-7 appears in our catalog under these names: Fmoc–D–Gln–OH, Fmoc-D-Gln-OH, Fmoc-D-Gln-OH 98%, N2-[(9H-Fluoren-9-ylmethoxy)carbonyl]-D-glutamine, 98%, 98%, Fmoc-D-Gln, 97%. Offered by: GLPBio, Iris Biotech, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 100g, 10g.
(2R)-5-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxopentanoic acid (CAS 112898-00-7) is a chemical compound with the molecular formula C20H20N2O5 and a molecular weight of 368.4 g/mol. IUPAC name: (2R)-5-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxopentanoic acid. InChIKey: IZKGGDFLLNVXNZ-QGZVFWFLSA-N.
| Molecular formula | C20H20N2O5 |
|---|---|
| Molecular weight | 368.4 g/mol |
| IUPAC name | (2R)-5-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxopentanoic acid |
| InChIKey | IZKGGDFLLNVXNZ-QGZVFWFLSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CCC(=O)N)C(=O)O |
Computed by PubChem (NCBI)