Products 112904-78-6
CAS 112904-78-6 appears in our catalog under these names: 5-Methoxychroman-3-carboxylic acid, 95%, 5–Methoxychroman–3–carboxylic acid, 5-Methoxychroman-3-carboxylic Acid, 5-Methoxychroman-3-carboxylic acid 97%, 5-Methoxychroman-3-carboxylic acid, 97%, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 5g, 100mg.
5-methoxy-3,4-dihydro-2H-chromene-3-carboxylic acid (CAS 112904-78-6) is a chemical compound with the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. IUPAC name: 5-methoxy-3,4-dihydro-2H-chromene-3-carboxylic acid. InChIKey: XMGAJGALUQJCQE-UHFFFAOYSA-N.
| Molecular formula | C11H12O4 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | 5-methoxy-3,4-dihydro-2H-chromene-3-carboxylic acid |
| InChIKey | XMGAJGALUQJCQE-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC2=C1CC(CO2)C(=O)O |
Computed by PubChem (NCBI)