CAS 112935-93-0 appears in our catalog under these names: 5-(1-Hydroxyethyl)-1,3-phenylene bis(dimethylcarbamate), 98%, Bambuterol EP Impurity D, Bambuterol Impurity 3, 5-Des(2-(tert-butylamino)) Bambuterol-5-ethanol, >95% (HPLC), 5-((1RS)-1-Hydroxyethyl)-1,3-phenylene Bis(dimethylcarbamate). Offered by: Chemat Brand, Hubei YoungXin, TRC, Mikromol. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg.
[3-(dimethylcarbamoyloxy)-5-(1-hydroxyethyl)phenyl] N,N-dimethylcarbamate (CAS 112935-93-0) is a chemical compound with the molecular formula C14H20N2O5 and a molecular weight of 296.32 g/mol. IUPAC name: [3-(dimethylcarbamoyloxy)-5-(1-hydroxyethyl)phenyl] N,N-dimethylcarbamate. InChIKey: GSPOTIPIYTUHQP-UHFFFAOYSA-N.
| Molecular formula | C14H20N2O5 |
|---|---|
| Molecular weight | 296.32 g/mol |
| IUPAC name | [3-(dimethylcarbamoyloxy)-5-(1-hydroxyethyl)phenyl] N,N-dimethylcarbamate |
| InChIKey | GSPOTIPIYTUHQP-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=CC(=C1)OC(=O)N(C)C)OC(=O)N(C)C)O |
Computed by PubChem (NCBI)