CAS 1212298-83-3 appears in our catalog under these names: Boc-(r)-3-amino-3-(6-methoxy-3-pyridyl)-propionic acid, 95%, (R)-3-((tert-Butoxycarbonyl)amino)-3-(6-methoxypyridin-3-yl)propanoic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g, 100mg.
(3R)-3-(6-methoxy-3-pyridinyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 1212298-83-3) is a chemical compound with the molecular formula C14H20N2O5 and a molecular weight of 296.32 g/mol. IUPAC name: (3R)-3-(6-methoxy-3-pyridinyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: WAZLXMQVYNXDQH-SNVBAGLBSA-N.
| Molecular formula | C14H20N2O5 |
|---|---|
| Molecular weight | 296.32 g/mol |
| IUPAC name | (3R)-3-(6-methoxy-3-pyridinyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | WAZLXMQVYNXDQH-SNVBAGLBSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC(=O)O)C1=CN=C(C=C1)OC |
Computed by PubChem (NCBI)