CAS 1422344-17-9 is the registry number for 5-tert-Butyl 2-ethyl 6,7-dihydrooxazolo[5,4-c]pyridine-2,5(4h)-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
5-O-tert-butyl 2-O-ethyl 6,7-dihydro-4H-[1,3]oxazolo[5,4-c]pyridine-2,5-dicarboxylate (CAS 1422344-17-9) is a chemical compound with the molecular formula C14H20N2O5 and a molecular weight of 296.32 g/mol. IUPAC name: 5-O-tert-butyl 2-O-ethyl 6,7-dihydro-4H-[1,3]oxazolo[5,4-c]pyridine-2,5-dicarboxylate. InChIKey: HXVHTNHXSBCTTB-UHFFFAOYSA-N.
| Molecular formula | C14H20N2O5 |
|---|---|
| Molecular weight | 296.32 g/mol |
| IUPAC name | 5-O-tert-butyl 2-O-ethyl 6,7-dihydro-4H-[1,3]oxazolo[5,4-c]pyridine-2,5-dicarboxylate |
| InChIKey | HXVHTNHXSBCTTB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC2=C(O1)CN(CC2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)