Products 73057-36-0

CAS 73057-36-0 is the registry number for Nicotine Malate. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 500mg.

Structural formula: {0} (CAS {1})

2-hydroxybutanedioic acid;3-[(2S)-1-methylpyrrolidin-2-yl]pyridine (CAS 73057-36-0) is a chemical compound with the molecular formula C14H20N2O5 and a molecular weight of 296.32 g/mol. IUPAC name: 2-hydroxybutanedioic acid;3-[(2S)-1-methylpyrrolidin-2-yl]pyridine. InChIKey: OEOMLCRMCASNOR-PPHPATTJSA-N.

Identity
Molecular formulaC14H20N2O5
Molecular weight296.32 g/mol
IUPAC name2-hydroxybutanedioic acid;3-[(2S)-1-methylpyrrolidin-2-yl]pyridine
InChIKeyOEOMLCRMCASNOR-PPHPATTJSA-N
SMILESCN1CCC[C@H]1C2=CN=CC=C2.C(C(C(=O)O)O)C(=O)O

Computed by PubChem (NCBI)