CAS 73057-36-0 is the registry number for Nicotine Malate. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 500mg.
2-hydroxybutanedioic acid;3-[(2S)-1-methylpyrrolidin-2-yl]pyridine (CAS 73057-36-0) is a chemical compound with the molecular formula C14H20N2O5 and a molecular weight of 296.32 g/mol. IUPAC name: 2-hydroxybutanedioic acid;3-[(2S)-1-methylpyrrolidin-2-yl]pyridine. InChIKey: OEOMLCRMCASNOR-PPHPATTJSA-N.
| Molecular formula | C14H20N2O5 |
|---|---|
| Molecular weight | 296.32 g/mol |
| IUPAC name | 2-hydroxybutanedioic acid;3-[(2S)-1-methylpyrrolidin-2-yl]pyridine |
| InChIKey | OEOMLCRMCASNOR-PPHPATTJSA-N |
| SMILES | CN1CCC[C@H]1C2=CN=CC=C2.C(C(C(=O)O)O)C(=O)O |
Computed by PubChem (NCBI)