CAS 1361116-93-9 is the registry number for 3-(1-(tert-Butoxycarbonyl)piperidin-3-yl)isoxazole-5-carboxylic acid, 97%. Offered by: AmBeed. Available pack sizes: 1g.
3-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-3-yl]-1,2-oxazole-5-carboxylic acid (CAS 1361116-93-9) is a chemical compound with the molecular formula C14H20N2O5 and a molecular weight of 296.32 g/mol. IUPAC name: 3-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-3-yl]-1,2-oxazole-5-carboxylic acid. InChIKey: ZDILURCPZRUDDW-UHFFFAOYSA-N.
| Molecular formula | C14H20N2O5 |
|---|---|
| Molecular weight | 296.32 g/mol |
| IUPAC name | 3-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-3-yl]-1,2-oxazole-5-carboxylic acid |
| InChIKey | ZDILURCPZRUDDW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC(C1)C2=NOC(=C2)C(=O)O |
Computed by PubChem (NCBI)