Products 113003-49-9
CAS 113003-49-9 appears in our catalog under these names: alpha-Chloro-9-anthraldoxime, Alpha-chloro-9-anthraldoxime, 95%, N-Hydroxyanthracene-9-carbimidoyl chloride, 98%. Offered by: Chemat, Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 25g, 5g.
(9E)-N-hydroxyanthracene-9-carboximidoyl chloride (CAS 113003-49-9) is a chemical compound with the molecular formula C15H10ClNO and a molecular weight of 255.70 g/mol. IUPAC name: (9E)-N-hydroxyanthracene-9-carboximidoyl chloride. InChIKey: HNCKUONLZVGZKH-BMRADRMJSA-N.
| Molecular formula | C15H10ClNO |
|---|---|
| Molecular weight | 255.70 g/mol |
| IUPAC name | (9E)-N-hydroxyanthracene-9-carboximidoyl chloride |
| InChIKey | HNCKUONLZVGZKH-BMRADRMJSA-N |
| SMILES | C1=CC=C2C(=C1)C=C3C=CC=CC3=C2/C(=N\O)/Cl |
Computed by PubChem (NCBI)