CAS 76049-81-5 is the registry number for Bromfenac Impurity 46. Offered by: Chemat Brand. Available pack sizes: on request.
(3-chloro-1H-indol-7-yl)-phenylmethanone (CAS 76049-81-5) is a chemical compound with the molecular formula C15H10ClNO and a molecular weight of 255.70 g/mol. IUPAC name: (3-chloro-1H-indol-7-yl)-phenylmethanone. InChIKey: LIYBKYYMGXDDRN-UHFFFAOYSA-N.
| Molecular formula | C15H10ClNO |
|---|---|
| Molecular weight | 255.70 g/mol |
| IUPAC name | (3-chloro-1H-indol-7-yl)-phenylmethanone |
| InChIKey | LIYBKYYMGXDDRN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC=CC3=C2NC=C3Cl |
Computed by PubChem (NCBI)