CAS 30169-33-6 appears in our catalog under these names: 6-Chloro-4-phenylquinolin-2(1H)-one, 6-Chloro-4-phenyl-1,2-dihydroquinolin-2-one, 95%, 6-Chloro-4-phenylquinolin-2(1H)-one, 95%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 5g, 0,5g, 250mg, 1g.
6-chloro-4-phenyl-1H-quinolin-2-one (CAS 30169-33-6) is a chemical compound with the molecular formula C15H10ClNO and a molecular weight of 255.70 g/mol. IUPAC name: 6-chloro-4-phenyl-1H-quinolin-2-one. InChIKey: IJUHQVBVAUVMEG-UHFFFAOYSA-N.
| Molecular formula | C15H10ClNO |
|---|---|
| Molecular weight | 255.70 g/mol |
| IUPAC name | 6-chloro-4-phenyl-1H-quinolin-2-one |
| InChIKey | IJUHQVBVAUVMEG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=O)NC3=C2C=C(C=C3)Cl |
Computed by PubChem (NCBI)