CAS 558424-57-0 is the registry number for 2-(4-Chlorophenyl)indolizine-3-carbaldehyde. Offered by: Biosynth. Available pack sizes: 10g, 1g.
2-(4-chlorophenyl)indolizine-3-carbaldehyde (CAS 558424-57-0) is a chemical compound with the molecular formula C15H10ClNO and a molecular weight of 255.70 g/mol. IUPAC name: 2-(4-chlorophenyl)indolizine-3-carbaldehyde. InChIKey: BHZHIJDNUJCYFI-UHFFFAOYSA-N.
| Molecular formula | C15H10ClNO |
|---|---|
| Molecular weight | 255.70 g/mol |
| IUPAC name | 2-(4-chlorophenyl)indolizine-3-carbaldehyde |
| InChIKey | BHZHIJDNUJCYFI-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=C(N2C=C1)C=O)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)