CAS 22397-40-6 is the registry number for 2-(2-Chlorophenyl)-5-phenyloxazole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
2-(2-chlorophenyl)-5-phenyl-1,3-oxazole (CAS 22397-40-6) is a chemical compound with the molecular formula C15H10ClNO and a molecular weight of 255.70 g/mol. IUPAC name: 2-(2-chlorophenyl)-5-phenyl-1,3-oxazole. InChIKey: IZRRJUCIEXYYBW-UHFFFAOYSA-N.
| Molecular formula | C15H10ClNO |
|---|---|
| Molecular weight | 255.70 g/mol |
| IUPAC name | 2-(2-chlorophenyl)-5-phenyl-1,3-oxazole |
| InChIKey | IZRRJUCIEXYYBW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CN=C(O2)C3=CC=CC=C3Cl |
Computed by PubChem (NCBI)