Products 113072-25-6
CAS 113072-25-6 appears in our catalog under these names: 2,5-Dichloro-6-methylbenzo[d]thiazole, 96%, Benzothiazole, 2,5-dichloro-6-methyl- (9CI), 96%, 96%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
2,5-dichloro-6-methyl-1,3-benzothiazole (CAS 113072-25-6) is a chemical compound with the molecular formula C8H5Cl2NS and a molecular weight of 218.10 g/mol. IUPAC name: 2,5-dichloro-6-methyl-1,3-benzothiazole. InChIKey: SSSAVIDRGVJMEB-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2NS |
|---|---|
| Molecular weight | 218.10 g/mol |
| IUPAC name | 2,5-dichloro-6-methyl-1,3-benzothiazole |
| InChIKey | SSSAVIDRGVJMEB-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1Cl)N=C(S2)Cl |
Computed by PubChem (NCBI)