Products 113122-54-6
CAS 113122-54-6 appears in our catalog under these names: 3-Deoxysappanone B, Deoxysappanone B. Offered by: Biosynth, MedChemExpress. Available pack sizes: 10mg, 5mg, 25mg, 50mg, 5 mg, 1 mg.
3-[(3,4-dihydroxyphenyl)methyl]-7-hydroxy-2,3-dihydrochromen-4-one (CAS 113122-54-6) is a chemical compound with the molecular formula C16H14O5 and a molecular weight of 286.28 g/mol. IUPAC name: 3-[(3,4-dihydroxyphenyl)methyl]-7-hydroxy-2,3-dihydrochromen-4-one. InChIKey: KCUXSQJYIWEGRG-UHFFFAOYSA-N.
| Molecular formula | C16H14O5 |
|---|---|
| Molecular weight | 286.28 g/mol |
| IUPAC name | 3-[(3,4-dihydroxyphenyl)methyl]-7-hydroxy-2,3-dihydrochromen-4-one |
| InChIKey | KCUXSQJYIWEGRG-UHFFFAOYSA-N |
| SMILES | C1C(C(=O)C2=C(O1)C=C(C=C2)O)CC3=CC(=C(C=C3)O)O |
Computed by PubChem (NCBI)