Products 1131594-24-5
CAS 1131594-24-5 appears in our catalog under these names: 3–Bromo–4–morpholinobenzoic Acid, 3-Bromo-4-morpholinobenzoic acid 97%, 3-Bromo-4-morpholinobenzoic Acid, 98%, 98%, 3-Bromo-4-morpholinobenzoic acid, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 10g, 25g, 100mg.
3-bromo-4-morpholin-4-ylbenzoic acid (CAS 1131594-24-5) is a chemical compound with the molecular formula C11H12BrNO3 and a molecular weight of 286.12 g/mol. IUPAC name: 3-bromo-4-morpholin-4-ylbenzoic acid. InChIKey: XPMSVZSWUDDSAW-UHFFFAOYSA-N.
| Molecular formula | C11H12BrNO3 |
|---|---|
| Molecular weight | 286.12 g/mol |
| IUPAC name | 3-bromo-4-morpholin-4-ylbenzoic acid |
| InChIKey | XPMSVZSWUDDSAW-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=C(C=C(C=C2)C(=O)O)Br |
Computed by PubChem (NCBI)