CAS 1131610-84-8 appears in our catalog under these names: Thiotolyl β–D–ribofuranoside, Thiotolyl b-D-ribofuranoside, Thiotolyl β-D-ribofuranoside 98%, (2R,3S,4R,5S)-2-(Hydroxymethyl)-5-(p-tolylthio)tetrahydrofuran-3,4-diol, 98%, 98%, Thiotolyl β-D-ribofuranoside. Offered by: GLPBio, Biosynth, Ambeed, Chemat, MedChemExpress. Available pack sizes: 25g, 5g, 10g, 1g, 1 g, 5 g, 10 g, 250 mg.
(2R,3S,4R,5S)-2-(hydroxymethyl)-5-(4-methylphenyl)sulfanyloxolane-3,4-diol (CAS 1131610-84-8) is a chemical compound with the molecular formula C12H16O4S and a molecular weight of 256.32 g/mol. IUPAC name: (2R,3S,4R,5S)-2-(hydroxymethyl)-5-(4-methylphenyl)sulfanyloxolane-3,4-diol. InChIKey: HAIKIYVHHZHPJW-KKOKHZNYSA-N.
| Molecular formula | C12H16O4S |
|---|---|
| Molecular weight | 256.32 g/mol |
| IUPAC name | (2R,3S,4R,5S)-2-(hydroxymethyl)-5-(4-methylphenyl)sulfanyloxolane-3,4-diol |
| InChIKey | HAIKIYVHHZHPJW-KKOKHZNYSA-N |
| SMILES | CC1=CC=C(C=C1)S[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)O |
Computed by PubChem (NCBI)