Products 32415-78-4

CAS 32415-78-4 is the registry number for O-Ethyl 3,4,5-trimethoxybenzothioate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

O-ethyl 3,4,5-trimethoxybenzenecarbothioate (CAS 32415-78-4) is a chemical compound with the molecular formula C12H16O4S and a molecular weight of 256.32 g/mol. IUPAC name: O-ethyl 3,4,5-trimethoxybenzenecarbothioate. InChIKey: BONKUDCBMFTQFQ-UHFFFAOYSA-N.

Identity
Molecular formulaC12H16O4S
Molecular weight256.32 g/mol
IUPAC nameO-ethyl 3,4,5-trimethoxybenzenecarbothioate
InChIKeyBONKUDCBMFTQFQ-UHFFFAOYSA-N
SMILESCCOC(=S)C1=CC(=C(C(=C1)OC)OC)OC

Computed by PubChem (NCBI)