Products 945362-32-3
CAS 945362-32-3 appears in our catalog under these names: 2-[(3-Methylbutyl)sulfonyl]benzoic acid, 95%, 2-(Isopentylsulfonyl)benzoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-(3-methylbutylsulfonyl)benzoic acid (CAS 945362-32-3) is a chemical compound with the molecular formula C12H16O4S and a molecular weight of 256.32 g/mol. IUPAC name: 2-(3-methylbutylsulfonyl)benzoic acid. InChIKey: NYWXQJKLQDTPLG-UHFFFAOYSA-N.
| Molecular formula | C12H16O4S |
|---|---|
| Molecular weight | 256.32 g/mol |
| IUPAC name | 2-(3-methylbutylsulfonyl)benzoic acid |
| InChIKey | NYWXQJKLQDTPLG-UHFFFAOYSA-N |
| SMILES | CC(C)CCS(=O)(=O)C1=CC=CC=C1C(=O)O |
Computed by PubChem (NCBI)