Products 22415-60-7

CAS 22415-60-7 is the registry number for (R)-(Tetrahydrofuran-2-yl)methyl 4-methylbenzenesulfonate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100mg, 250mg, 5g.

Structural formula: {0} (CAS {1})

[(2R)-oxolan-2-yl]methyl 4-methylbenzenesulfonate (CAS 22415-60-7) is a chemical compound with the molecular formula C12H16O4S and a molecular weight of 256.32 g/mol. IUPAC name: [(2R)-oxolan-2-yl]methyl 4-methylbenzenesulfonate. InChIKey: FDMKROMOVVBUIJ-LLVKDONJSA-N.

Identity
Molecular formulaC12H16O4S
Molecular weight256.32 g/mol
IUPAC name[(2R)-oxolan-2-yl]methyl 4-methylbenzenesulfonate
InChIKeyFDMKROMOVVBUIJ-LLVKDONJSA-N
SMILESCC1=CC=C(C=C1)S(=O)(=O)OC[C@H]2CCCO2

Computed by PubChem (NCBI)