CAS 22415-60-7 is the registry number for (R)-(Tetrahydrofuran-2-yl)methyl 4-methylbenzenesulfonate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100mg, 250mg, 5g.
[(2R)-oxolan-2-yl]methyl 4-methylbenzenesulfonate (CAS 22415-60-7) is a chemical compound with the molecular formula C12H16O4S and a molecular weight of 256.32 g/mol. IUPAC name: [(2R)-oxolan-2-yl]methyl 4-methylbenzenesulfonate. InChIKey: FDMKROMOVVBUIJ-LLVKDONJSA-N.
| Molecular formula | C12H16O4S |
|---|---|
| Molecular weight | 256.32 g/mol |
| IUPAC name | [(2R)-oxolan-2-yl]methyl 4-methylbenzenesulfonate |
| InChIKey | FDMKROMOVVBUIJ-LLVKDONJSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OC[C@H]2CCCO2 |
Computed by PubChem (NCBI)