CAS 204918-49-0 appears in our catalog under these names: P-Tolyl-1-thio-alpha-d-arabinofuranoside, 95%, p-Tolyl-1-thio-α-D-arabinofuranoside. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 250mg, 1g, 500mg, 1000mg.
(2R,3S,4S,5R)-2-(hydroxymethyl)-5-(4-methylphenyl)sulfanyloxolane-3,4-diol (CAS 204918-49-0) is a chemical compound with the molecular formula C12H16O4S and a molecular weight of 256.32 g/mol. IUPAC name: (2R,3S,4S,5R)-2-(hydroxymethyl)-5-(4-methylphenyl)sulfanyloxolane-3,4-diol. InChIKey: HAIKIYVHHZHPJW-WISYIIOYSA-N.
| Molecular formula | C12H16O4S |
|---|---|
| Molecular weight | 256.32 g/mol |
| IUPAC name | (2R,3S,4S,5R)-2-(hydroxymethyl)-5-(4-methylphenyl)sulfanyloxolane-3,4-diol |
| InChIKey | HAIKIYVHHZHPJW-WISYIIOYSA-N |
| SMILES | CC1=CC=C(C=C1)S[C@@H]2[C@H]([C@@H]([C@H](O2)CO)O)O |
Computed by PubChem (NCBI)