CAS 1132638-92-6 is the registry number for Telmisartan Impurity 13. Offered by: Chemat Brand. Available pack sizes: on request.
2,7-dimethyl-3H-benzimidazole-5-carboxylic acid (CAS 1132638-92-6) is a chemical compound with the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. IUPAC name: 2,7-dimethyl-3H-benzimidazole-5-carboxylic acid. InChIKey: YAGNOBFAVSYHKR-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O2 |
|---|---|
| Molecular weight | 190.20 g/mol |
| IUPAC name | 2,7-dimethyl-3H-benzimidazole-5-carboxylic acid |
| InChIKey | YAGNOBFAVSYHKR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC2=C1N=C(N2)C)C(=O)O |
Computed by PubChem (NCBI)