Products 1132638-92-6

CAS 1132638-92-6 is the registry number for Telmisartan Impurity 13. Offered by: Chemat Brand. Available pack sizes: on request.

2,7-dimethyl-3H-benzimidazole-5-carboxylic acid (CAS 1132638-92-6) is a chemical compound with the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. IUPAC name: 2,7-dimethyl-3H-benzimidazole-5-carboxylic acid. InChIKey: YAGNOBFAVSYHKR-UHFFFAOYSA-N.

Identity
Molecular formulaC10H10N2O2
Molecular weight190.20 g/mol
IUPAC name2,7-dimethyl-3H-benzimidazole-5-carboxylic acid
InChIKeyYAGNOBFAVSYHKR-UHFFFAOYSA-N
SMILESCC1=CC(=CC2=C1N=C(N2)C)C(=O)O

Computed by PubChem (NCBI)