CAS 1133115-70-4 is the registry number for Methyl 4-chloro-7,8-dimethylquinoline-2-carboxylate, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 5g.
Methyl 4-chloro-7,8-dimethylquinoline-2-carboxylate (CAS 1133115-70-4) is a chemical compound with the molecular formula C13H12ClNO2 and a molecular weight of 249.69 g/mol. IUPAC name: methyl 4-chloro-7,8-dimethylquinoline-2-carboxylate. InChIKey: VZYCKZKXAVZPOB-UHFFFAOYSA-N.
| Molecular formula | C13H12ClNO2 |
|---|---|
| Molecular weight | 249.69 g/mol |
| IUPAC name | methyl 4-chloro-7,8-dimethylquinoline-2-carboxylate |
| InChIKey | VZYCKZKXAVZPOB-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=C1)C(=CC(=N2)C(=O)OC)Cl)C |
Computed by PubChem (NCBI)