CAS 62966-75-0 appears in our catalog under these names: 5-Chloro-2-(4-methoxyphenoxy)aniline, 95%, 5-Chloro-2-(4-methoxyphenoxy)aniline hydrochloride, 98%, 5-Chloro-2-(4-methoxyphenoxy)aniline. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg, 0,5g.
5-chloro-2-(4-methoxyphenoxy)aniline (CAS 62966-75-0) is a chemical compound with the molecular formula C13H12ClNO2 and a molecular weight of 249.69 g/mol. IUPAC name: 5-chloro-2-(4-methoxyphenoxy)aniline. InChIKey: MOKCOIMRDYVYNH-UHFFFAOYSA-N.
| Molecular formula | C13H12ClNO2 |
|---|---|
| Molecular weight | 249.69 g/mol |
| IUPAC name | 5-chloro-2-(4-methoxyphenoxy)aniline |
| InChIKey | MOKCOIMRDYVYNH-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)OC2=C(C=C(C=C2)Cl)N |
Computed by PubChem (NCBI)