CAS 60217-76-7 appears in our catalog under these names: 1-(4-Chlorophenyl)-2,5-dimethyl-1h-pyrrole-3-carboxylic acid, 95%, 1-(4-Chlorophenyl)-2,5-dimethyl-1H-pyrrole-3-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
1-(4-chlorophenyl)-2,5-dimethylpyrrole-3-carboxylic acid (CAS 60217-76-7) is a chemical compound with the molecular formula C13H12ClNO2 and a molecular weight of 249.69 g/mol. IUPAC name: 1-(4-chlorophenyl)-2,5-dimethylpyrrole-3-carboxylic acid. InChIKey: CCMUJMMWBQLMFO-UHFFFAOYSA-N.
| Molecular formula | C13H12ClNO2 |
|---|---|
| Molecular weight | 249.69 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-2,5-dimethylpyrrole-3-carboxylic acid |
| InChIKey | CCMUJMMWBQLMFO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N1C2=CC=C(C=C2)Cl)C)C(=O)O |
Computed by PubChem (NCBI)