Products 26165-62-8

CAS 26165-62-8 is the registry number for 4-Chloro-3-(2,5-dimethyl-1h-pyrrol-1-yl)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 1g, 5g.

Structural formula: {0} (CAS {1})

4-chloro-3-(2,5-dimethylpyrrol-1-yl)benzoic acid (CAS 26165-62-8) is a chemical compound with the molecular formula C13H12ClNO2 and a molecular weight of 249.69 g/mol. IUPAC name: 4-chloro-3-(2,5-dimethylpyrrol-1-yl)benzoic acid. InChIKey: RDTROARYSPBJMT-UHFFFAOYSA-N.

Identity
Molecular formulaC13H12ClNO2
Molecular weight249.69 g/mol
IUPAC name4-chloro-3-(2,5-dimethylpyrrol-1-yl)benzoic acid
InChIKeyRDTROARYSPBJMT-UHFFFAOYSA-N
SMILESCC1=CC=C(N1C2=C(C=CC(=C2)C(=O)O)Cl)C

Computed by PubChem (NCBI)